C19H28N6OS — CID 142518116
ethane;methanethiol;6-(3-methylmorpholin-4-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-amine (PubChem CID 142518116) has the molecular formula C19H28N6OS and a molecular weight of 388.54 g/mol. Its IUPAC name is ethane;methanethiol;6-(3-methylmorpholin-4-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-amine.
| Compound Name | ethane;methanethiol;6-(3-methylmorpholin-4-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 142518116 |
| Molecular Formula | C19H28N6OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | ethane;methanethiol;6-(3-methylmorpholin-4-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-amine |
| SMILES | CC.CC1COCCN1c1cc(N)nc(-c2ccnc3[nH]ccc23)n1.CS |
| InChI | InChI=1S/C16H18N6O.C2H6.CH4S/c1-10-9-23-7-6-22(10)14-8-13(17)20-16(21-14)12-3-5-19-15-11(12)2-4-18-15;2*1-2/h2-5,8,10H,6-7,9H2,1H3,(H,18,19)(H2,17,20,21);1-2H3;2H,1H3 |
| InChIKey | LZQGAZSICDJJNN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|