C20H25N7OS — CID 142533087
3-methyl-4-[6-(6-methyl-1,2,6-thiadiazinan-2-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]morpholine (PubChem CID 142533087) has the molecular formula C20H25N7OS and a molecular weight of 411.54 g/mol. Its IUPAC name is 3-methyl-4-[6-(6-methyl-1,2,6-thiadiazinan-2-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]morpholine.
| Compound Name | 3-methyl-4-[6-(6-methyl-1,2,6-thiadiazinan-2-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 142533087 |
| Molecular Formula | C20H25N7OS |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-methyl-4-[6-(6-methyl-1,2,6-thiadiazinan-2-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]morpholine |
| SMILES | CC1COCCN1c1cc(N2CCCN(C)S2)nc(-c2ccnc3[nH]ccc23)n1 |
| InChI | InChI=1S/C20H25N7OS/c1-14-13-28-11-10-26(14)17-12-18(27-9-3-8-25(2)29-27)24-20(23-17)16-5-7-22-19-15(16)4-6-21-19/h4-7,12,14H,3,8-11,13H2,1-2H3,(H,21,22) |
| InChIKey | XANWMRGFPNKNAF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|