C22H28N8O — CID 139406127
(Z)-1-[amino(cyclopropyl)amino]-1-[6-(3-methylmorpholin-4-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]prop-1-en-2-amine (PubChem CID 139406127) has the molecular formula C22H28N8O and a molecular weight of 420.52 g/mol. Its IUPAC name is (Z)-1-[amino(cyclopropyl)amino]-1-[6-(3-methylmorpholin-4-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(cyclopropyl)amino]-1-[6-(3-methylmorpholin-4-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 139406127 |
| Molecular Formula | C22H28N8O |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (Z)-1-[amino(cyclopropyl)amino]-1-[6-(3-methylmorpholin-4-yl)-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]prop-1-en-2-amine |
| SMILES | C/C(N)=C(\c1cc(N2CCOCC2C)nc(-c2ccnc3[nH]ccc23)n1)N(N)C1CC1 |
| InChI | InChI=1S/C22H28N8O/c1-13-12-31-10-9-29(13)19-11-18(20(14(2)23)30(24)15-3-4-15)27-22(28-19)17-6-8-26-21-16(17)5-7-25-21/h5-8,11,13,15H,3-4,9-10,12,23-24H2,1-2H3,(H,25,26)/b20-14- |
| InChIKey | FYDOBVSRBWMWEJ-ZHZULCJRSA-N |
| XLogP | 2.23 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|