C18H23ClN6OS — CID 142518005
2-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methylsulfanylmethane (PubChem CID 142518005) has the molecular formula C18H23ClN6OS and a molecular weight of 406.94 g/mol. Its IUPAC name is 2-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methylsulfanylmethane.
| Compound Name | 2-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methylsulfanylmethane |
|---|---|
| PubChem CID | 142518005 |
| Molecular Formula | C18H23ClN6OS |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methylsulfanylmethane |
| SMILES | CC1COCCN1c1cc(N)nc(-c2cc(Cl)nc3[nH]ccc23)n1.CSC |
| InChI | InChI=1S/C16H17ClN6O.C2H6S/c1-9-8-24-5-4-23(9)14-7-13(18)21-16(22-14)11-6-12(17)20-15-10(11)2-3-19-15;1-3-2/h2-3,6-7,9H,4-5,8H2,1H3,(H,19,20)(H2,18,21,22);1-2H3 |
| InChIKey | VVAXKLSNWNXRGZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|