C20H22ClN5O3S — CID 137498325
(2R)-2-[2-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-4-yl]thiolane 1,1-dioxide (PubChem CID 137498325) has the molecular formula C20H22ClN5O3S and a molecular weight of 447.95 g/mol. Its IUPAC name is (2R)-2-[2-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-4-yl]thiolane 1,1-dioxide.
| Compound Name | (2R)-2-[2-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-4-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 137498325 |
| Molecular Formula | C20H22ClN5O3S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (2R)-2-[2-(6-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-4-yl]thiolane 1,1-dioxide |
| SMILES | C[C@@H]1COCCN1c1cc([C@H]2CCCS2(=O)=O)nc(-c2cc(Cl)nc3[nH]ccc23)n1 |
| InChI | InChI=1S/C20H22ClN5O3S/c1-12-11-29-7-6-26(12)18-10-15(16-3-2-8-30(16,27)28)23-20(25-18)14-9-17(21)24-19-13(14)4-5-22-19/h4-5,9-10,12,16H,2-3,6-8,11H2,1H3,(H,22,24)/t12-,16-/m1/s1 |
| InChIKey | FJQLYBZQSJEUED-MLGOLLRUSA-N |
| XLogP | 3.15 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|