C18H22ClN5O3S — CID 137498437
6-chloro-4-[4-(1,1-dioxothiolan-2-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-2-yl]pyridin-2-amine (PubChem CID 137498437) has the molecular formula C18H22ClN5O3S and a molecular weight of 423.93 g/mol. Its IUPAC name is 6-chloro-4-[4-(1,1-dioxothiolan-2-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-2-yl]pyridin-2-amine.
| Compound Name | 6-chloro-4-[4-(1,1-dioxothiolan-2-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 137498437 |
| Molecular Formula | C18H22ClN5O3S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 6-chloro-4-[4-(1,1-dioxothiolan-2-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-2-yl]pyridin-2-amine |
| SMILES | CC1COCCN1c1cc(C2CCCS2(=O)=O)nc(-c2cc(N)nc(Cl)c2)n1 |
| InChI | InChI=1S/C18H22ClN5O3S/c1-11-10-27-5-4-24(11)17-9-13(14-3-2-6-28(14,25)26)21-18(23-17)12-7-15(19)22-16(20)8-12/h7-9,11,14H,2-6,10H2,1H3,(H2,20,22) |
| InChIKey | NNRIAAPTBLEEPK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|