C19H30N6O3S — CID 142518032
2-(2-amino-6-methoxy-4-pyridinyl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methanethiol;oxetane (PubChem CID 142518032) has the molecular formula C19H30N6O3S and a molecular weight of 422.56 g/mol. Its IUPAC name is 2-(2-amino-6-methoxy-4-pyridinyl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methanethiol;oxetane.
| Compound Name | 2-(2-amino-6-methoxy-4-pyridinyl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methanethiol;oxetane |
|---|---|
| PubChem CID | 142518032 |
| Molecular Formula | C19H30N6O3S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-(2-amino-6-methoxy-4-pyridinyl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methanethiol;oxetane |
| SMILES | C1COC1.COc1cc(-c2nc(N)cc(N3CCOCC3C)n2)cc(N)n1.CS |
| InChI | InChI=1S/C15H20N6O2.C3H6O.CH4S/c1-9-8-23-4-3-21(9)13-7-12(17)19-15(20-13)10-5-11(16)18-14(6-10)22-2;1-2-4-3-1;1-2/h5-7,9H,3-4,8H2,1-2H3,(H2,16,18)(H2,17,19,20);1-3H2;2H,1H3 |
| InChIKey | WQAZXTSUYIMMIR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|