C18H20ClF3N4OSi — CID 142533724
2-[[4-chloro-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142533724) has the molecular formula C18H20ClF3N4OSi and a molecular weight of 428.92 g/mol. Its IUPAC name is 2-[[4-chloro-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-chloro-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142533724 |
| Molecular Formula | C18H20ClF3N4OSi |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-[[4-chloro-2-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cnc(C(F)(F)F)nc2)cc2c(Cl)ccnc21 |
| InChI | InChI=1S/C18H20ClF3N4OSi/c1-28(2,3)7-6-27-11-26-15(8-13-14(19)4-5-23-16(13)26)12-9-24-17(25-10-12)18(20,21)22/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | WGUQJNJMDIUJLQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|