C19H19F3N4S — CID 142535036
2-(1-ethylimidazol-4-yl)-4-(methylaminosulfanyl)-N-[3-(trifluoromethyl)phenyl]aniline (PubChem CID 142535036) has the molecular formula C19H19F3N4S and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-(1-ethylimidazol-4-yl)-4-(methylaminosulfanyl)-N-[3-(trifluoromethyl)phenyl]aniline.
| Compound Name | 2-(1-ethylimidazol-4-yl)-4-(methylaminosulfanyl)-N-[3-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 142535036 |
| Molecular Formula | C19H19F3N4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(1-ethylimidazol-4-yl)-4-(methylaminosulfanyl)-N-[3-(trifluoromethyl)phenyl]aniline |
| SMILES | CCn1cnc(-c2cc(SNC)ccc2Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H19F3N4S/c1-3-26-11-18(24-12-26)16-10-15(27-23-2)7-8-17(16)25-14-6-4-5-13(9-14)19(20,21)22/h4-12,23,25H,3H2,1-2H3 |
| InChIKey | AKZFUNBRQQZKCV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|