C26H29F3N4O — CID 162379013
N-[4-(hexan-3-ylamino)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]phenyl]prop-2-enamide (PubChem CID 162379013) has the molecular formula C26H29F3N4O and a molecular weight of 470.54 g/mol. Its IUPAC name is N-[4-(hexan-3-ylamino)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-(hexan-3-ylamino)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162379013 |
| Molecular Formula | C26H29F3N4O |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-[4-(hexan-3-ylamino)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(NC(CC)CCC)c(-c2cn(Cc3cccc(C(F)(F)F)c3)cn2)c1 |
| InChI | InChI=1S/C26H29F3N4O/c1-4-8-20(5-2)31-23-12-11-21(32-25(34)6-3)14-22(23)24-16-33(17-30-24)15-18-9-7-10-19(13-18)26(27,28)29/h6-7,9-14,16-17,20,31H,3-5,8,15H2,1-2H3,(H,32,34) |
| InChIKey | AASJWOFPHUSPTE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|