C24H21F3N4O2 — CID 171514620
N-[3-[1-(2-methoxyethyl)imidazol-4-yl]-1-[4-(trifluoromethyl)phenyl]indol-5-yl]prop-2-enamide (PubChem CID 171514620) has the molecular formula C24H21F3N4O2 and a molecular weight of 454.45 g/mol. Its IUPAC name is N-[3-[1-(2-methoxyethyl)imidazol-4-yl]-1-[4-(trifluoromethyl)phenyl]indol-5-yl]prop-2-enamide.
| Compound Name | N-[3-[1-(2-methoxyethyl)imidazol-4-yl]-1-[4-(trifluoromethyl)phenyl]indol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171514620 |
| Molecular Formula | C24H21F3N4O2 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-[3-[1-(2-methoxyethyl)imidazol-4-yl]-1-[4-(trifluoromethyl)phenyl]indol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)c(-c1cn(CCOC)cn1)cn2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H21F3N4O2/c1-3-23(32)29-17-6-9-22-19(12-17)20(21-14-30(15-28-21)10-11-33-2)13-31(22)18-7-4-16(5-8-18)24(25,26)27/h3-9,12-15H,1,10-11H2,2H3,(H,29,32) |
| InChIKey | QMEDSGZEUWUUHL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|