C22H14F3N3O2 — CID 46228024
2-oxo-N-pyridin-4-yl-2-[1-[4-(trifluoromethyl)phenyl]indol-3-yl]acetamide (PubChem CID 46228024) has the molecular formula C22H14F3N3O2 and a molecular weight of 409.37 g/mol. Its IUPAC name is 2-oxo-N-pyridin-4-yl-2-[1-[4-(trifluoromethyl)phenyl]indol-3-yl]acetamide.
| Compound Name | 2-oxo-N-pyridin-4-yl-2-[1-[4-(trifluoromethyl)phenyl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 46228024 |
| Molecular Formula | C22H14F3N3O2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-oxo-N-pyridin-4-yl-2-[1-[4-(trifluoromethyl)phenyl]indol-3-yl]acetamide |
| SMILES | O=C(Nc1ccncc1)C(=O)c1cn(-c2ccc(C(F)(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C22H14F3N3O2/c23-22(24,25)14-5-7-16(8-6-14)28-13-18(17-3-1-2-4-19(17)28)20(29)21(30)27-15-9-11-26-12-10-15/h1-13H,(H,26,27,30) |
| InChIKey | FYJBYODIAFGMSM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|