C18H12F6N2O6 — CID 160804799
1-pyridin-3-ylindole-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 160804799) has the molecular formula C18H12F6N2O6 and a molecular weight of 466.29 g/mol. Its IUPAC name is 1-pyridin-3-ylindole-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-pyridin-3-ylindole-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 160804799 |
| Molecular Formula | C18H12F6N2O6 |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 1-pyridin-3-ylindole-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)c1cn(-c2cccnc2)c2ccccc12 |
| InChI | InChI=1S/C14H10N2O2.2C2HF3O2/c17-14(18)12-9-16(10-4-3-7-15-8-10)13-6-2-1-5-11(12)13;2*3-2(4,5)1(6)7/h1-9H,(H,17,18);2*(H,6,7) |
| InChIKey | SDNVLQIVBJJIOC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |