C17H11N3O2 — CID 69214784
1-(1-pyridin-3-ylindol-3-yl)pyrrole-2,5-dione (PubChem CID 69214784) has the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-(1-pyridin-3-ylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-(1-pyridin-3-ylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69214784 |
| Molecular Formula | C17H11N3O2 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-(1-pyridin-3-ylindol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1cn(-c2cccnc2)c2ccccc12 |
| InChI | InChI=1S/C17H11N3O2/c21-16-7-8-17(22)20(16)15-11-19(12-4-3-9-18-10-12)14-6-2-1-5-13(14)15/h1-11H |
| InChIKey | QGRHPYBCCXMMCV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|