C21H20ClF3N4O3 — CID 4305072
3-chloro-N-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]propanamide (PubChem CID 4305072) has the molecular formula C21H20ClF3N4O3 and a molecular weight of 468.86 g/mol. Its IUPAC name is 3-chloro-N-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]propanamide.
| Compound Name | 3-chloro-N-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 4305072 |
| Molecular Formula | C21H20ClF3N4O3 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 3-chloro-N-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]propanamide |
| SMILES | COCCOc1nc(-c2ccc(C(F)(F)F)cc2)n(-c2ccc(NC(=O)CCCl)cc2)n1 |
| InChI | InChI=1S/C21H20ClF3N4O3/c1-31-12-13-32-20-27-19(14-2-4-15(5-3-14)21(23,24)25)29(28-20)17-8-6-16(7-9-17)26-18(30)10-11-22/h2-9H,10-13H2,1H3,(H,26,30) |
| InChIKey | FJCGGMNRRKOHGM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|