C22H22ClF3N4O2 — CID 3674172
4-chloro-N-[4-[3-propan-2-yloxy-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]butanamide (PubChem CID 3674172) has the molecular formula C22H22ClF3N4O2 and a molecular weight of 466.89 g/mol. Its IUPAC name is 4-chloro-N-[4-[3-propan-2-yloxy-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]butanamide.
| Compound Name | 4-chloro-N-[4-[3-propan-2-yloxy-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 3674172 |
| Molecular Formula | C22H22ClF3N4O2 |
| Molecular Weight | 466.89 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4-chloro-N-[4-[3-propan-2-yloxy-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]butanamide |
| SMILES | CC(C)Oc1nc(-c2ccc(C(F)(F)F)cc2)n(-c2ccc(NC(=O)CCCCl)cc2)n1 |
| InChI | InChI=1S/C22H22ClF3N4O2/c1-14(2)32-21-28-20(15-5-7-16(8-6-15)22(24,25)26)30(29-21)18-11-9-17(10-12-18)27-19(31)4-3-13-23/h5-12,14H,3-4,13H2,1-2H3,(H,27,31) |
| InChIKey | WZGCRBUGCKDYCE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.89 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|