C27H27F3N4O4 — CID 46014119
1-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]-3-phenoxypropan-2-ol (PubChem CID 46014119) has the molecular formula C27H27F3N4O4 and a molecular weight of 528.53 g/mol. Its IUPAC name is 1-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 46014119 |
| Molecular Formula | C27H27F3N4O4 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 1-[4-[3-(2-methoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]-3-phenoxypropan-2-ol |
| SMILES | COCCOc1nc(-c2ccc(C(F)(F)F)cc2)n(-c2ccc(NCC(O)COc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C27H27F3N4O4/c1-36-15-16-37-26-32-25(19-7-9-20(10-8-19)27(28,29)30)34(33-26)22-13-11-21(12-14-22)31-17-23(35)18-38-24-5-3-2-4-6-24/h2-14,23,31,35H,15-18H2,1H3 |
| InChIKey | NODLBCBJEPRDKZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|