C21H26N4O3 — CID 42838549
1-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]anilino]propan-2-ol (PubChem CID 42838549) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]anilino]propan-2-ol.
| Compound Name | 1-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 42838549 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]anilino]propan-2-ol |
| SMILES | COCCOc1nc(-c2ccccc2C)n(-c2ccc(NCC(C)O)cc2)n1 |
| InChI | InChI=1S/C21H26N4O3/c1-15-6-4-5-7-19(15)20-23-21(28-13-12-27-3)24-25(20)18-10-8-17(9-11-18)22-14-16(2)26/h4-11,16,22,26H,12-14H2,1-3H3 |
| InChIKey | LONYOORXNBNEHH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|