C22H25F3N4O3 — CID 46014147
1-[4-[3-(2-ethoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]propan-2-ol (PubChem CID 46014147) has the molecular formula C22H25F3N4O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is 1-[4-[3-(2-ethoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]propan-2-ol.
| Compound Name | 1-[4-[3-(2-ethoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 46014147 |
| Molecular Formula | C22H25F3N4O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 1-[4-[3-(2-ethoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]anilino]propan-2-ol |
| SMILES | CCOCCOc1nc(-c2ccc(C(F)(F)F)cc2)n(-c2ccc(NCC(C)O)cc2)n1 |
| InChI | InChI=1S/C22H25F3N4O3/c1-3-31-12-13-32-21-27-20(16-4-6-17(7-5-16)22(23,24)25)29(28-21)19-10-8-18(9-11-19)26-14-15(2)30/h4-11,15,26,30H,3,12-14H2,1-2H3 |
| InChIKey | QTCXNJISMZGOQZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|