C28H38N4O3 — CID 4536600
N-[4-[3-(2-ethoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-3,5,5-trimethylhexanamide (PubChem CID 4536600) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[4-[3-(2-ethoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[4-[3-(2-ethoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 4536600 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | N-[4-[3-(2-ethoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-3,5,5-trimethylhexanamide |
| SMILES | CCOCCOc1nc(-c2ccc(C)cc2)n(-c2ccc(NC(=O)CC(C)CC(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C28H38N4O3/c1-7-34-16-17-35-27-30-26(22-10-8-20(2)9-11-22)32(31-27)24-14-12-23(13-15-24)29-25(33)18-21(3)19-28(4,5)6/h8-15,21H,7,16-19H2,1-6H3,(H,29,33) |
| InChIKey | TYRZAFLHHIWKSD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|