C25H22Cl2N4O3 — CID 3403706
3,4-dichloro-N-[4-[3-(2-methoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide (PubChem CID 3403706) has the molecular formula C25H22Cl2N4O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[3-(2-methoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-[3-(2-methoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 3403706 |
| Molecular Formula | C25H22Cl2N4O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 3,4-dichloro-N-[4-[3-(2-methoxyethoxy)-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide |
| SMILES | COCCOc1nc(-c2ccc(C)cc2)n(-c2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cc2)n1 |
| InChI | InChI=1S/C25H22Cl2N4O3/c1-16-3-5-17(6-4-16)23-29-25(34-14-13-33-2)30-31(23)20-10-8-19(9-11-20)28-24(32)18-7-12-21(26)22(27)15-18/h3-12,15H,13-14H2,1-2H3,(H,28,32) |
| InChIKey | HHVAAORJCSBLIQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|