C19H16Cl2N4O3S — CID 146249428
N-[4-[5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-2-sulfanylideneacetamide (PubChem CID 146249428) has the molecular formula C19H16Cl2N4O3S and a molecular weight of 451.34 g/mol. Its IUPAC name is N-[4-[5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-2-sulfanylideneacetamide.
| Compound Name | N-[4-[5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 146249428 |
| Molecular Formula | C19H16Cl2N4O3S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | N-[4-[5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-2-sulfanylideneacetamide |
| SMILES | COCCOc1nc(-c2ccc(Cl)c(Cl)c2)n(-c2ccc(NC(=O)C=S)cc2)n1 |
| InChI | InChI=1S/C19H16Cl2N4O3S/c1-27-8-9-28-19-23-18(12-2-7-15(20)16(21)10-12)25(24-19)14-5-3-13(4-6-14)22-17(26)11-29/h2-7,10-11H,8-9H2,1H3,(H,22,26) |
| InChIKey | OKWZAGODZHARQN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|