C21H23ClN4O3 — CID 4173586
2-chloro-N-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]propanamide (PubChem CID 4173586) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 2-chloro-N-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]propanamide.
| Compound Name | 2-chloro-N-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 4173586 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-chloro-N-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]propanamide |
| SMILES | COCCOc1nc(-c2ccccc2C)n(-c2ccc(NC(=O)C(C)Cl)cc2)n1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-14-6-4-5-7-18(14)19-24-21(29-13-12-28-3)25-26(19)17-10-8-16(9-11-17)23-20(27)15(2)22/h4-11,15H,12-13H2,1-3H3,(H,23,27) |
| InChIKey | IESZWEVWUUMWEL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|