C26H26N4O3 — CID 42810017
N-[3-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methylbenzamide (PubChem CID 42810017) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[3-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 42810017 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[3-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methylbenzamide |
| SMILES | COCCOc1nc(-c2ccccc2C)n(-c2cccc(NC(=O)c3ccc(C)cc3)c2)n1 |
| InChI | InChI=1S/C26H26N4O3/c1-18-11-13-20(14-12-18)25(31)27-21-8-6-9-22(17-21)30-24(23-10-5-4-7-19(23)2)28-26(29-30)33-16-15-32-3/h4-14,17H,15-16H2,1-3H3,(H,27,31) |
| InChIKey | PKNJCFXUHMWKNB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|