C26H25FN4O3 — CID 24718282
N-[3-[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-fluorobenzamide (PubChem CID 24718282) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is N-[3-[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[3-[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 24718282 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[3-[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-fluorobenzamide |
| SMILES | CCOCCOc1nc(-c2ccccc2C)n(-c2cccc(NC(=O)c3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C26H25FN4O3/c1-3-33-15-16-34-26-29-24(23-10-5-4-7-18(23)2)31(30-26)22-9-6-8-21(17-22)28-25(32)19-11-13-20(27)14-12-19/h4-14,17H,3,15-16H2,1-2H3,(H,28,32) |
| InChIKey | BSXUWAWSENPUAB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|