C27H27FN4O3 — CID 3568210
N-[4-[3-(2-ethoxyethoxy)-5-(3-fluorophenyl)-1,2,4-triazol-1-yl]phenyl]-4-ethylbenzamide (PubChem CID 3568210) has the molecular formula C27H27FN4O3 and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[4-[3-(2-ethoxyethoxy)-5-(3-fluorophenyl)-1,2,4-triazol-1-yl]phenyl]-4-ethylbenzamide.
| Compound Name | N-[4-[3-(2-ethoxyethoxy)-5-(3-fluorophenyl)-1,2,4-triazol-1-yl]phenyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 3568210 |
| Molecular Formula | C27H27FN4O3 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-[4-[3-(2-ethoxyethoxy)-5-(3-fluorophenyl)-1,2,4-triazol-1-yl]phenyl]-4-ethylbenzamide |
| SMILES | CCOCCOc1nc(-c2cccc(F)c2)n(-c2ccc(NC(=O)c3ccc(CC)cc3)cc2)n1 |
| InChI | InChI=1S/C27H27FN4O3/c1-3-19-8-10-20(11-9-19)26(33)29-23-12-14-24(15-13-23)32-25(21-6-5-7-22(28)18-21)30-27(31-32)35-17-16-34-4-2/h5-15,18H,3-4,16-17H2,1-2H3,(H,29,33) |
| InChIKey | ARKSWJFRAVYKJI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|