C26H21Cl2F3N4O3 — CID 42665165
2,4-dichloro-N-[4-[3-(2-ethoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide (PubChem CID 42665165) has the molecular formula C26H21Cl2F3N4O3 and a molecular weight of 565.38 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[3-(2-ethoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[3-(2-ethoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42665165 |
| Molecular Formula | C26H21Cl2F3N4O3 |
| Molecular Weight | 565.38 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | 2,4-dichloro-N-[4-[3-(2-ethoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide |
| SMILES | CCOCCOc1nc(-c2cccc(C(F)(F)F)c2)n(-c2ccc(NC(=O)c3ccc(Cl)cc3Cl)cc2)n1 |
| InChI | InChI=1S/C26H21Cl2F3N4O3/c1-2-37-12-13-38-25-33-23(16-4-3-5-17(14-16)26(29,30)31)35(34-25)20-9-7-19(8-10-20)32-24(36)21-11-6-18(27)15-22(21)28/h3-11,14-15H,2,12-13H2,1H3,(H,32,36) |
| InChIKey | OGLNVODTTPUCSA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.38 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|