C25H20F4N4O3 — CID 46134180
2-fluoro-N-[3-[3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide (PubChem CID 46134180) has the molecular formula C25H20F4N4O3 and a molecular weight of 500.45 g/mol. Its IUPAC name is 2-fluoro-N-[3-[3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 46134180 |
| Molecular Formula | C25H20F4N4O3 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-fluoro-N-[3-[3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide |
| SMILES | COCCOc1nc(-c2cccc(C(F)(F)F)c2)n(-c2cccc(NC(=O)c3ccccc3F)c2)n1 |
| InChI | InChI=1S/C25H20F4N4O3/c1-35-12-13-36-24-31-22(16-6-4-7-17(14-16)25(27,28)29)33(32-24)19-9-5-8-18(15-19)30-23(34)20-10-2-3-11-21(20)26/h2-11,14-15H,12-13H2,1H3,(H,30,34) |
| InChIKey | LXTQXYWQYKJYDA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|