C20H19F3N4O3 — CID 42778616
N-[4-[3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]acetamide (PubChem CID 42778616) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[4-[3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 42778616 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[4-[3-(2-methoxyethoxy)-5-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]acetamide |
| SMILES | COCCOc1nc(-c2cccc(C(F)(F)F)c2)n(-c2ccc(NC(C)=O)cc2)n1 |
| InChI | InChI=1S/C20H19F3N4O3/c1-13(28)24-16-6-8-17(9-7-16)27-18(25-19(26-27)30-11-10-29-2)14-4-3-5-15(12-14)20(21,22)23/h3-9,12H,10-11H2,1-2H3,(H,24,28) |
| InChIKey | WBFOAKQYSNOSDZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|