C25H21FN4O5 — CID 42809860
N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-3-fluorobenzamide (PubChem CID 42809860) has the molecular formula C25H21FN4O5 and a molecular weight of 476.46 g/mol. Its IUPAC name is N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 42809860 |
| Molecular Formula | C25H21FN4O5 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-3-fluorobenzamide |
| SMILES | COCCOc1nc(-c2ccc3c(c2)OCO3)n(-c2ccc(NC(=O)c3cccc(F)c3)cc2)n1 |
| InChI | InChI=1S/C25H21FN4O5/c1-32-11-12-33-25-28-23(16-5-10-21-22(14-16)35-15-34-21)30(29-25)20-8-6-19(7-9-20)27-24(31)17-3-2-4-18(26)13-17/h2-10,13-14H,11-12,15H2,1H3,(H,27,31) |
| InChIKey | AVCQOAZAWOHMBV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|