C22H23ClN4O4 — CID 42778478
N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-2-chloropropanamide (PubChem CID 42778478) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-2-chloropropanamide.
| Compound Name | N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-2-chloropropanamide |
|---|---|
| PubChem CID | 42778478 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-2-chloropropanamide |
| SMILES | CC(C)COc1nc(-c2ccc3c(c2)OCO3)n(-c2ccc(NC(=O)C(C)Cl)cc2)n1 |
| InChI | InChI=1S/C22H23ClN4O4/c1-13(2)11-29-22-25-20(15-4-9-18-19(10-15)31-12-30-18)27(26-22)17-7-5-16(6-8-17)24-21(28)14(3)23/h4-10,13-14H,11-12H2,1-3H3,(H,24,28) |
| InChIKey | IJPSAVDURAWDGH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|