C26H22ClN5O6 — CID 42665253
N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-4-chloro-3-nitrobenzamide (PubChem CID 42665253) has the molecular formula C26H22ClN5O6 and a molecular weight of 535.94 g/mol. Its IUPAC name is N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 42665253 |
| Molecular Formula | C26H22ClN5O6 |
| Molecular Weight | 535.94 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | N-[4-[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]-4-chloro-3-nitrobenzamide |
| SMILES | CC(C)COc1nc(-c2ccc3c(c2)OCO3)n(-c2ccc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)cc2)n1 |
| InChI | InChI=1S/C26H22ClN5O6/c1-15(2)13-36-26-29-24(16-4-10-22-23(12-16)38-14-37-22)31(30-26)19-7-5-18(6-8-19)28-25(33)17-3-9-20(27)21(11-17)32(34)35/h3-12,15H,13-14H2,1-2H3,(H,28,33) |
| InChIKey | KENBLPXWJGEARS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|