C20H17ClN4O6 — CID 42730107
[5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]-(2-chloro-4-nitrophenyl)methanone (PubChem CID 42730107) has the molecular formula C20H17ClN4O6 and a molecular weight of 444.83 g/mol. Its IUPAC name is [5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]-(2-chloro-4-nitrophenyl)methanone.
| Compound Name | [5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]-(2-chloro-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42730107 |
| Molecular Formula | C20H17ClN4O6 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [5-(1,3-benzodioxol-5-yl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]-(2-chloro-4-nitrophenyl)methanone |
| SMILES | CC(C)COc1nc(-c2ccc3c(c2)OCO3)n(C(=O)c2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C20H17ClN4O6/c1-11(2)9-29-20-22-18(12-3-6-16-17(7-12)31-10-30-16)24(23-20)19(26)14-5-4-13(25(27)28)8-15(14)21/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | OYMOOKBNIMOSLK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 118.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|