C20H17Cl2N3O5 — CID 42730123
[5-(1,3-benzodioxol-5-yl)-3-(2-ethoxyethoxy)-1,2,4-triazol-1-yl]-(2,4-dichlorophenyl)methanone (PubChem CID 42730123) has the molecular formula C20H17Cl2N3O5 and a molecular weight of 450.28 g/mol. Its IUPAC name is [5-(1,3-benzodioxol-5-yl)-3-(2-ethoxyethoxy)-1,2,4-triazol-1-yl]-(2,4-dichlorophenyl)methanone.
| Compound Name | [5-(1,3-benzodioxol-5-yl)-3-(2-ethoxyethoxy)-1,2,4-triazol-1-yl]-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 42730123 |
| Molecular Formula | C20H17Cl2N3O5 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | [5-(1,3-benzodioxol-5-yl)-3-(2-ethoxyethoxy)-1,2,4-triazol-1-yl]-(2,4-dichlorophenyl)methanone |
| SMILES | CCOCCOc1nc(-c2ccc3c(c2)OCO3)n(C(=O)c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H17Cl2N3O5/c1-2-27-7-8-28-20-23-18(12-3-6-16-17(9-12)30-11-29-16)25(24-20)19(26)14-5-4-13(21)10-15(14)22/h3-6,9-10H,2,7-8,11H2,1H3 |
| InChIKey | BKSYVOIZZQFWFH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|