C19H17Cl2N3O3 — CID 42730398
(2-chlorophenyl)-[5-(3-chlorophenyl)-3-(2-ethoxyethoxy)-1,2,4-triazol-1-yl]methanone (PubChem CID 42730398) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is (2-chlorophenyl)-[5-(3-chlorophenyl)-3-(2-ethoxyethoxy)-1,2,4-triazol-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[5-(3-chlorophenyl)-3-(2-ethoxyethoxy)-1,2,4-triazol-1-yl]methanone |
|---|---|
| PubChem CID | 42730398 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (2-chlorophenyl)-[5-(3-chlorophenyl)-3-(2-ethoxyethoxy)-1,2,4-triazol-1-yl]methanone |
| SMILES | CCOCCOc1nc(-c2cccc(Cl)c2)n(C(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C19H17Cl2N3O3/c1-2-26-10-11-27-19-22-17(13-6-5-7-14(20)12-13)24(23-19)18(25)15-8-3-4-9-16(15)21/h3-9,12H,2,10-11H2,1H3 |
| InChIKey | UDNNVPILHHCICT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|