C19H26ClN3O3 — CID 42730413
1-[5-(3-chlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]-2-ethylhexan-1-one (PubChem CID 42730413) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]-2-ethylhexan-1-one.
| Compound Name | 1-[5-(3-chlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]-2-ethylhexan-1-one |
|---|---|
| PubChem CID | 42730413 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-[5-(3-chlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]-2-ethylhexan-1-one |
| SMILES | CCCCC(CC)C(=O)n1nc(OCCOC)nc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-4-6-8-14(5-2)18(24)23-17(15-9-7-10-16(20)13-15)21-19(22-23)26-12-11-25-3/h7,9-10,13-14H,4-6,8,11-12H2,1-3H3 |
| InChIKey | QSFYTYCFDBMPEP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|