C22H25ClN4O2 — CID 1029331
(2S)-2-chloro-N-[4-[5-(2-methylphenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]propanamide (PubChem CID 1029331) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is (2S)-2-chloro-N-[4-[5-(2-methylphenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]propanamide.
| Compound Name | (2S)-2-chloro-N-[4-[5-(2-methylphenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 1029331 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2S)-2-chloro-N-[4-[5-(2-methylphenyl)-3-(2-methylpropoxy)-1,2,4-triazol-1-yl]phenyl]propanamide |
| SMILES | Cc1ccccc1-c1nc(OCC(C)C)nn1-c1ccc(NC(=O)[C@H](C)Cl)cc1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-14(2)13-29-22-25-20(19-8-6-5-7-15(19)3)27(26-22)18-11-9-17(10-12-18)24-21(28)16(4)23/h5-12,14,16H,13H2,1-4H3,(H,24,28)/t16-/m0/s1 |
| InChIKey | JGNVKXKIWPEVRD-INIZCTEOSA-N |
| XLogP | 4.84 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|