C27H28N4O5 — CID 4049573
3,5-dimethoxy-N-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide (PubChem CID 4049573) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4049573 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3,5-dimethoxy-N-[4-[3-(2-methoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide |
| SMILES | COCCOc1nc(-c2ccccc2C)n(-c2ccc(NC(=O)c3cc(OC)cc(OC)c3)cc2)n1 |
| InChI | InChI=1S/C27H28N4O5/c1-18-7-5-6-8-24(18)25-29-27(36-14-13-33-2)30-31(25)21-11-9-20(10-12-21)28-26(32)19-15-22(34-3)17-23(16-19)35-4/h5-12,15-17H,13-14H2,1-4H3,(H,28,32) |
| InChIKey | ZUDQYHHRYKYFQI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|