C25H24N5O6- — CID 163815701
3-[hydroxy(oxido)amino]-N-[4-[3-(2-methoxyethoxy)-5-(3-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide (PubChem CID 163815701) has the molecular formula C25H24N5O6- and a molecular weight of 490.50 g/mol. Its IUPAC name is 3-[hydroxy(oxido)amino]-N-[4-[3-(2-methoxyethoxy)-5-(3-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide.
| Compound Name | 3-[hydroxy(oxido)amino]-N-[4-[3-(2-methoxyethoxy)-5-(3-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 163815701 |
| Molecular Formula | C25H24N5O6- |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-[hydroxy(oxido)amino]-N-[4-[3-(2-methoxyethoxy)-5-(3-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]benzamide |
| SMILES | COCCOc1nc(-c2cccc(OC)c2)n(-c2ccc(NC(=O)c3cccc(N([O-])O)c3)cc2)n1 |
| InChI | InChI=1S/C25H24N5O6/c1-34-13-14-36-25-27-23(17-5-4-8-22(16-17)35-2)29(28-25)20-11-9-19(10-12-20)26-24(31)18-6-3-7-21(15-18)30(32)33/h3-12,15-16,32H,13-14H2,1-2H3,(H,26,31)/q-1 |
| InChIKey | LXTGZFRMRKQIFO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|