C23H21FN4O4 — CID 83276924
4-fluoro-N-[3-[5-(furan-2-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-3-methylbenzamide (PubChem CID 83276924) has the molecular formula C23H21FN4O4 and a molecular weight of 436.44 g/mol. Its IUPAC name is 4-fluoro-N-[3-[5-(furan-2-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-3-methylbenzamide.
| Compound Name | 4-fluoro-N-[3-[5-(furan-2-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 83276924 |
| Molecular Formula | C23H21FN4O4 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 4-fluoro-N-[3-[5-(furan-2-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]-3-methylbenzamide |
| SMILES | COCCOc1nc(-c2ccco2)n(-c2cccc(NC(=O)c3ccc(F)c(C)c3)c2)n1 |
| InChI | InChI=1S/C23H21FN4O4/c1-15-13-16(8-9-19(15)24)22(29)25-17-5-3-6-18(14-17)28-21(20-7-4-10-31-20)26-23(27-28)32-12-11-30-2/h3-10,13-14H,11-12H2,1-2H3,(H,25,29) |
| InChIKey | VHMJXRZCBAHDOW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|