C31H27N5O5 — CID 42809870
N-[3-[3-[2-(4-methoxyphenyl)ethoxy]-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-nitrobenzamide (PubChem CID 42809870) has the molecular formula C31H27N5O5 and a molecular weight of 549.59 g/mol. Its IUPAC name is N-[3-[3-[2-(4-methoxyphenyl)ethoxy]-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[3-[2-(4-methoxyphenyl)ethoxy]-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42809870 |
| Molecular Formula | C31H27N5O5 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | N-[3-[3-[2-(4-methoxyphenyl)ethoxy]-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-nitrobenzamide |
| SMILES | COc1ccc(CCOc2nc(-c3ccc(C)cc3)n(-c3cccc(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)n2)cc1 |
| InChI | InChI=1S/C31H27N5O5/c1-21-6-10-23(11-7-21)29-33-31(41-19-18-22-8-16-28(40-2)17-9-22)34-35(29)27-5-3-4-25(20-27)32-30(37)24-12-14-26(15-13-24)36(38)39/h3-17,20H,18-19H2,1-2H3,(H,32,37) |
| InChIKey | RWTHBEUILVJODT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|