C25H23N5O4 — CID 1027015
N-[4-[3-ethoxy-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methyl-3-nitrobenzamide (PubChem CID 1027015) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[4-[3-ethoxy-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-[3-ethoxy-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 1027015 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[4-[3-ethoxy-5-(4-methylphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCOc1nc(-c2ccc(C)cc2)n(-c2ccc(NC(=O)c3ccc(C)c([N+](=O)[O-])c3)cc2)n1 |
| InChI | InChI=1S/C25H23N5O4/c1-4-34-25-27-23(18-8-5-16(2)6-9-18)29(28-25)21-13-11-20(12-14-21)26-24(31)19-10-7-17(3)22(15-19)30(32)33/h5-15H,4H2,1-3H3,(H,26,31) |
| InChIKey | APGWOCAWXXVPCZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|