C22H19F2N5O4 — CID 42809783
1-(2,4-difluorophenyl)-3-[3-[5-(furan-2-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]urea (PubChem CID 42809783) has the molecular formula C22H19F2N5O4 and a molecular weight of 455.42 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[3-[5-(furan-2-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[3-[5-(furan-2-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 42809783 |
| Molecular Formula | C22H19F2N5O4 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[3-[5-(furan-2-yl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]urea |
| SMILES | COCCOc1nc(-c2ccco2)n(-c2cccc(NC(=O)Nc3ccc(F)cc3F)c2)n1 |
| InChI | InChI=1S/C22H19F2N5O4/c1-31-10-11-33-22-27-20(19-6-3-9-32-19)29(28-22)16-5-2-4-15(13-16)25-21(30)26-18-8-7-14(23)12-17(18)24/h2-9,12-13H,10-11H2,1H3,(H2,25,26,30) |
| InChIKey | DQHODDIXKSGCNQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|