C25H32N4O3 — CID 4565410
N-[4-[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]hexanamide (PubChem CID 4565410) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[4-[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]hexanamide.
| Compound Name | N-[4-[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 4565410 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-[4-[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(-n2nc(OCCOCC)nc2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-4-6-7-12-23(30)26-20-13-15-21(16-14-20)29-24(22-11-9-8-10-19(22)3)27-25(28-29)32-18-17-31-5-2/h8-11,13-16H,4-7,12,17-18H2,1-3H3,(H,26,30) |
| InChIKey | LFJARHDRTBJIGY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|