C26H33N3O3 — CID 42729974
[3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]-(4-hexylphenyl)methanone (PubChem CID 42729974) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is [3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]-(4-hexylphenyl)methanone.
| Compound Name | [3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]-(4-hexylphenyl)methanone |
|---|---|
| PubChem CID | 42729974 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | [3-(2-ethoxyethoxy)-5-(2-methylphenyl)-1,2,4-triazol-1-yl]-(4-hexylphenyl)methanone |
| SMILES | CCCCCCc1ccc(C(=O)n2nc(OCCOCC)nc2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C26H33N3O3/c1-4-6-7-8-12-21-14-16-22(17-15-21)25(30)29-24(23-13-10-9-11-20(23)3)27-26(28-29)32-19-18-31-5-2/h9-11,13-17H,4-8,12,18-19H2,1-3H3 |
| InChIKey | SBSNYCLEJFHVKK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|