C21H23N3O4 — CID 42731120
[5-(4-ethylphenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 42731120) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is [5-(4-ethylphenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [5-(4-ethylphenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 42731120 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [5-(4-ethylphenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | CCc1ccc(-c2nc(OCCOC)nn2C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-4-15-5-7-16(8-6-15)19-22-21(28-14-13-26-2)23-24(19)20(25)17-9-11-18(27-3)12-10-17/h5-12H,4,13-14H2,1-3H3 |
| InChIKey | UBBPVYKNPXTFTM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|