C27H35N3O2 — CID 42730344
[3-butoxy-5-(4-tert-butylphenyl)-1,2,4-triazol-1-yl]-(4-butylphenyl)methanone (PubChem CID 42730344) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is [3-butoxy-5-(4-tert-butylphenyl)-1,2,4-triazol-1-yl]-(4-butylphenyl)methanone.
| Compound Name | [3-butoxy-5-(4-tert-butylphenyl)-1,2,4-triazol-1-yl]-(4-butylphenyl)methanone |
|---|---|
| PubChem CID | 42730344 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | [3-butoxy-5-(4-tert-butylphenyl)-1,2,4-triazol-1-yl]-(4-butylphenyl)methanone |
| SMILES | CCCCOc1nc(-c2ccc(C(C)(C)C)cc2)n(C(=O)c2ccc(CCCC)cc2)n1 |
| InChI | InChI=1S/C27H35N3O2/c1-6-8-10-20-11-13-22(14-12-20)25(31)30-24(28-26(29-30)32-19-9-7-2)21-15-17-23(18-16-21)27(3,4)5/h11-18H,6-10,19H2,1-5H3 |
| InChIKey | OONHCVAWIQDWEY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|