C26H33N3O5 — CID 42727500
[3-butoxy-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]-(4-tert-butylphenyl)methanone (PubChem CID 42727500) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is [3-butoxy-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]-(4-tert-butylphenyl)methanone.
| Compound Name | [3-butoxy-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 42727500 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | [3-butoxy-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]-(4-tert-butylphenyl)methanone |
| SMILES | CCCCOc1nc(-c2cc(OC)c(OC)c(OC)c2)n(C(=O)c2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C26H33N3O5/c1-8-9-14-34-25-27-23(18-15-20(31-5)22(33-7)21(16-18)32-6)29(28-25)24(30)17-10-12-19(13-11-17)26(2,3)4/h10-13,15-16H,8-9,14H2,1-7H3 |
| InChIKey | TWBKWLPUATZVOD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|