C25H39N3O2 — CID 3960635
1-[3-butoxy-5-(4-tert-butylphenyl)-1,2,4-triazol-1-yl]nonan-1-one (PubChem CID 3960635) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 1-[3-butoxy-5-(4-tert-butylphenyl)-1,2,4-triazol-1-yl]nonan-1-one.
| Compound Name | 1-[3-butoxy-5-(4-tert-butylphenyl)-1,2,4-triazol-1-yl]nonan-1-one |
|---|---|
| PubChem CID | 3960635 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 1-[3-butoxy-5-(4-tert-butylphenyl)-1,2,4-triazol-1-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)n1nc(OCCCC)nc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H39N3O2/c1-6-8-10-11-12-13-14-22(29)28-23(26-24(27-28)30-19-9-7-2)20-15-17-21(18-16-20)25(3,4)5/h15-18H,6-14,19H2,1-5H3 |
| InChIKey | RWZZQHYJBIMHPK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|