C21H31N3O5 — CID 42727481
1-[3-propan-2-yloxy-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]heptan-1-one (PubChem CID 42727481) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-[3-propan-2-yloxy-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]heptan-1-one.
| Compound Name | 1-[3-propan-2-yloxy-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 42727481 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-[3-propan-2-yloxy-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)n1nc(OC(C)C)nc1-c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H31N3O5/c1-7-8-9-10-11-18(25)24-20(22-21(23-24)29-14(2)3)15-12-16(26-4)19(28-6)17(13-15)27-5/h12-14H,7-11H2,1-6H3 |
| InChIKey | RZUVHKYGEFICMT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|